
CAS 1057670-95-7
:2-Chloro-3,6-difluorobenzenepropanal
Description:
2-Chloro-3,6-difluorobenzenepropanal is an organic compound characterized by its unique structure, which includes a benzene ring substituted with chlorine and fluorine atoms, as well as an aldehyde functional group. The presence of the chlorine atom at the second position and two fluorine atoms at the third and sixth positions of the benzene ring contributes to its reactivity and polarity. This compound is likely to exhibit moderate volatility and solubility in polar solvents due to the electronegative halogen substituents. The aldehyde group makes it susceptible to oxidation and nucleophilic attack, which can be significant in various chemical reactions. Additionally, the presence of multiple halogens can influence its biological activity and environmental behavior, potentially making it a subject of interest in fields such as medicinal chemistry and agrochemicals. Safety data should be consulted for handling and storage, as halogenated compounds can pose health and environmental risks. Overall, 2-Chloro-3,6-difluorobenzenepropanal is a compound of interest due to its structural features and potential applications.
Formula:C9H7ClF2O
InChI:InChI=1S/C9H7ClF2O/c10-9-6(2-1-5-13)7(11)3-4-8(9)12/h3-5H,1-2H2
InChI key:InChIKey=NPAYYCZRGRROFC-UHFFFAOYSA-N
SMILES:C(CC=O)C1=C(Cl)C(F)=CC=C1F
Synonyms:- Benzenepropanal, 2-chloro-3,6-difluoro-
- 2-Chloro-3,6-difluorobenzenepropanal
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.