CAS 1057670-96-8

2-Chloro-4-fluorobenzenepropanal

Description:

2-Chloro-4-fluorobenzenepropanal, with the CAS number 1057670-96-8, is an organic compound characterized by its structure, which includes a benzene ring substituted with both a chlorine and a fluorine atom, along with a propanal functional group. This compound is typically classified as an aromatic aldehyde due to the presence of the aldehyde (-CHO) functional group. The chlorine and fluorine substituents contribute to its reactivity and influence its physical properties, such as boiling and melting points, as well as its solubility in various solvents. The presence of halogens often enhances the compound's electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions. Additionally, the compound may exhibit unique biological activities, making it of interest in medicinal chemistry and material science. Its synthesis and applications can be explored further in the context of organic synthesis and pharmaceutical development, where such halogenated compounds are often utilized for their specific reactivity and functional properties.

Formula: C₉H₈ClFO

InChI: InChI=1S/C9H8ClFO/c10-9-6-8(11)4-3-7(9)2-1-5-12/h3-6H,1-2H2

InChI key: InChIKey=JXLJCXPSRHOYAZ-UHFFFAOYSA-N

SMILES: C(CC=O)C1=C(Cl)C=C(F)C=C1

Synonyms:

• 2-Chloro-4-fluorobenzenepropanal
• Benzenepropanal, 2-chloro-4-fluoro-