
CAS 1057671-03-0
:3-Bromo-5-fluorobenzenepropanal
Description:
3-Bromo-5-fluorobenzenepropanal is an organic compound characterized by its structure, which includes a benzene ring substituted with both bromine and fluorine atoms, as well as an aldehyde functional group. The presence of the bromine and fluorine substituents contributes to its reactivity and influences its physical properties, such as boiling and melting points, which are typically higher than those of non-substituted benzene derivatives. The aldehyde group (-CHO) is known for its reactivity in various chemical reactions, including nucleophilic addition and oxidation. This compound may exhibit polar characteristics due to the electronegative halogen atoms, affecting its solubility in different solvents. Additionally, the specific arrangement of the substituents on the benzene ring can lead to unique chemical behavior, making it of interest in synthetic organic chemistry and potential applications in pharmaceuticals or agrochemicals. As with many halogenated compounds, safety precautions should be taken due to potential toxicity and environmental impact.
Formula:C9H8BrFO
InChI:InChI=1S/C9H8BrFO/c10-8-4-7(2-1-3-12)5-9(11)6-8/h3-6H,1-2H2
InChI key:InChIKey=PMBPUMYFFOPDFB-UHFFFAOYSA-N
SMILES:C(CC=O)C1=CC(Br)=CC(F)=C1
Synonyms:- Benzenepropanal, 3-bromo-5-fluoro-
- 3-Bromo-5-fluorobenzenepropanal
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.