CAS 1057671-07-4

3-Chloro-4-fluorobenzenepropanal

Description:

3-Chloro-4-fluorobenzenepropanal, with the CAS number 1057671-07-4, is an organic compound characterized by its structure, which includes a benzene ring substituted with both a chlorine atom and a fluorine atom, along with a propanal functional group. This compound is classified as an aromatic aldehyde due to the presence of the aldehyde (-CHO) functional group attached to a propyl chain. The chlorine and fluorine substituents contribute to its reactivity and influence its physical properties, such as boiling and melting points, as well as its solubility in various solvents. The presence of halogens typically enhances the compound's electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions. Additionally, the compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry and material science. However, specific safety and handling guidelines should be followed due to the potential hazards associated with halogenated compounds.

Formula: C₉H₈ClFO

InChI: InChI=1S/C9H8ClFO/c10-8-6-7(2-1-5-12)3-4-9(8)11/h3-6H,1-2H2

InChI key: InChIKey=RUZDLPUZAMKBMP-UHFFFAOYSA-N

SMILES: C(CC=O)C1=CC(Cl)=C(F)C=C1

Synonyms:

• 3-Chloro-4-fluorobenzenepropanal
• 3-(3-Chloro-4-fluorophenyl)propionaldehyde
• Benzenepropanal, 3-chloro-4-fluoro-