CAS 1057671-09-6

4-Chloro-2-fluorobenzenepropanal

Description:

4-Chloro-2-fluorobenzenepropanal is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with both a chlorine atom and a fluorine atom, as well as an aldehyde functional group. The presence of the chlorine and fluorine substituents contributes to its reactivity and potential applications in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. The aldehyde group (-CHO) is indicative of its potential as a precursor in organic synthesis, allowing for further functionalization. This compound is likely to exhibit moderate polarity due to the electronegative halogen atoms, influencing its solubility in polar solvents. Additionally, the presence of halogens can affect the compound's boiling and melting points compared to similar unsubstituted compounds. Safety data sheets should be consulted for handling and storage guidelines, as halogenated compounds can pose health and environmental risks. Overall, 4-Chloro-2-fluorobenzenepropanal is a valuable compound in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals.

Formula: C₉H₈ClFO

InChI: InChI=1S/C9H8ClFO/c10-8-4-3-7(2-1-5-12)9(11)6-8/h3-6H,1-2H2

InChI key: InChIKey=VOFJKSGJOUUMGR-UHFFFAOYSA-N

SMILES: C(CC=O)C1=C(F)C=C(Cl)C=C1

Synonyms:

• Benzenepropanal, 4-chloro-2-fluoro-
• 4-Chloro-2-fluorobenzenepropanal