CAS 1057671-44-9

2-Fluoro-3-(trifluoromethyl)benzenepropanol

Description:

2-Fluoro-3-(trifluoromethyl)benzenepropanol, identified by its CAS number 1057671-44-9, is a chemical compound characterized by the presence of a fluorinated aromatic ring and a propanol functional group. The molecule features a fluorine atom at the second position and a trifluoromethyl group at the third position of the benzene ring, which significantly influences its chemical properties, including polarity and reactivity. The presence of the hydroxyl (-OH) group in the propanol moiety contributes to its potential as an alcohol, affecting its solubility in polar solvents and its ability to participate in hydrogen bonding. This compound may exhibit unique biological activities due to its fluorinated structure, which can enhance metabolic stability and lipophilicity. Additionally, the trifluoromethyl group is known to impart distinctive electronic properties, making it of interest in medicinal chemistry and materials science. Overall, 2-Fluoro-3-(trifluoromethyl)benzenepropanol represents a versatile compound with potential applications in various chemical and pharmaceutical contexts.

Formula: C₁₀H₁₀F₄O

InChI: InChI=1S/C10H10F4O/c11-9-7(4-2-6-15)3-1-5-8(9)10(12,13)14/h1,3,5,15H,2,4,6H2

InChI key: InChIKey=ZZYJNXBOZGEPTO-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=C(F)C(CCCO)=CC=C1

Synonyms:

• 2-Fluoro-3-(trifluoromethyl)benzenepropanol
• Benzenepropanol, 2-fluoro-3-(trifluoromethyl)-