CAS 1057671-55-2

3-(Trifluoromethoxy)benzenepropanol

Description:

3-(Trifluoromethoxy)benzenepropanol, identified by its CAS number 1057671-55-2, is an organic compound characterized by the presence of a trifluoromethoxy group attached to a benzene ring, along with a propanol moiety. This compound features a benzene ring substituted at the meta position with a trifluoromethoxy group, which significantly influences its chemical properties, including polarity and reactivity. The trifluoromethoxy group is known for its electron-withdrawing characteristics, which can enhance the compound's acidity and affect its interactions with other molecules. The propanol part of the molecule introduces a hydroxyl (-OH) functional group, contributing to its potential as an alcohol and influencing its solubility in polar solvents. The presence of fluorine atoms typically enhances the compound's stability and may impart unique biological or pharmacological properties. Overall, 3-(Trifluoromethoxy)benzenepropanol is of interest in various fields, including medicinal chemistry and materials science, due to its distinctive structural features and potential applications.

Formula: C₁₀H₁₁F₃O₂

InChI: InChI=1S/C10H11F3O2/c11-10(12,13)15-9-5-1-3-8(7-9)4-2-6-14/h1,3,5,7,14H,2,4,6H2

InChI key: InChIKey=FUBCIAHXKPFUCB-UHFFFAOYSA-N

SMILES: O(C(F)(F)F)C1=CC(CCCO)=CC=C1

Synonyms:

• Benzenepropanol, 3-(trifluoromethoxy)-
• 3-(Trifluoromethoxy)benzenepropanol
• 3-(3-Trifluoromethoxyphenyl)-1-propanol