CAS 1057671-57-4

4-Chloro-3-fluorobenzenepropanol

Description:

4-Chloro-3-fluorobenzenepropanol is an organic compound characterized by the presence of a benzene ring substituted with both a chlorine and a fluorine atom, along with a propanol functional group. This compound features a three-carbon chain (propanol) that is attached to the benzene ring, which contributes to its reactivity and solubility properties. The chlorine and fluorine substituents can influence the compound's polarity, making it more soluble in polar solvents compared to non-polar solvents. Additionally, the presence of these halogens can affect the compound's biological activity, potentially making it useful in pharmaceutical applications. The compound's structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, due to the electrophilic nature of the halogenated benzene ring. Its specific physical properties, such as boiling point, melting point, and density, would depend on the molecular interactions and the arrangement of atoms within the compound. Overall, 4-Chloro-3-fluorobenzenepropanol is a versatile compound with potential applications in organic synthesis and medicinal chemistry.

Formula: C₉H₁₀ClFO

InChI: InChI=1S/C9H10ClFO/c10-8-4-3-7(2-1-5-12)6-9(8)11/h3-4,6,12H,1-2,5H2

InChI key: InChIKey=PGPUVUXYKHZXBP-UHFFFAOYSA-N

SMILES: C(CCO)C1=CC(F)=C(Cl)C=C1

Synonyms:

• 4-Chloro-3-fluorobenzenepropanol
• Benzenepropanol, 4-chloro-3-fluoro-