CymitQuimica logo

CAS 1057678-25-7

:

4-(3-Bromopropyl)-2-fluoro-1-methylbenzene

Description:
4-(3-Bromopropyl)-2-fluoro-1-methylbenzene, identified by its CAS number 1057678-25-7, is an organic compound characterized by a benzene ring substituted with a fluorine atom, a methyl group, and a 3-bromopropyl chain. This compound features a fluorine atom at the para position relative to the methyl group and a bromopropyl group at the meta position. The presence of the bromine atom introduces significant reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The fluorine atom contributes to the compound's lipophilicity and can influence its biological activity. The molecular structure suggests that it may exhibit interesting properties such as solubility in organic solvents and potential applications in pharmaceuticals or agrochemicals. Additionally, the presence of both bromine and fluorine atoms may enhance its stability and reactivity under certain conditions. Overall, this compound's unique structural features make it a subject of interest in synthetic organic chemistry and materials science.
Formula:C10H12BrF
InChI:InChI=1S/C10H12BrF/c1-8-4-5-9(3-2-6-11)7-10(8)12/h4-5,7H,2-3,6H2,1H3
InChI key:InChIKey=SLLLVQVVEVMUDH-UHFFFAOYSA-N
SMILES:C(CCBr)C1=CC(F)=C(C)C=C1
Synonyms:
  • 4-(3-Bromopropyl)-2-fluoro-1-methylbenzene
  • Benzene, 4-(3-bromopropyl)-2-fluoro-1-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.