CAS 1057678-45-1

2-(3-Bromopropyl)-1,4-difluorobenzene

Description:

2-(3-Bromopropyl)-1,4-difluorobenzene is an organic compound characterized by its unique structure, which includes a difluorobenzene ring substituted with a bromopropyl group. The presence of two fluorine atoms on the benzene ring significantly influences its chemical properties, including increased electronegativity and potential reactivity. The bromopropyl substituent introduces a longer alkyl chain, which can affect the compound's solubility and interaction with other molecules. This compound is likely to exhibit moderate polarity due to the combination of the bromine and fluorine atoms, which can participate in various chemical reactions, such as nucleophilic substitutions or electrophilic aromatic substitutions. Additionally, the presence of halogens may impart biological activity, making it of interest in medicinal chemistry and materials science. Safety considerations should be taken into account, as brominated and fluorinated compounds can pose environmental and health risks. Overall, 2-(3-Bromopropyl)-1,4-difluorobenzene is a versatile compound with potential applications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₉H₉BrF₂

InChI: InChI=1S/C9H9BrF2/c10-5-1-2-7-6-8(11)3-4-9(7)12/h3-4,6H,1-2,5H2

InChI key: InChIKey=IMWOYTFDJCPRFT-UHFFFAOYSA-N

SMILES: C(CCBr)C1=C(F)C=CC(F)=C1

Synonyms:

• Benzene, 2-(3-bromopropyl)-1,4-difluoro-
• 2-(3-Bromopropyl)-1,4-difluorobenzene