CymitQuimica logo

CAS 1057678-59-7

:

2-Bromo-4-(3-bromopropyl)-1-fluorobenzene

Description:
2-Bromo-4-(3-bromopropyl)-1-fluorobenzene is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a bromine atom at the second position, a fluorine atom at the first position, and a propyl group containing an additional bromine atom at the fourth position. This compound is part of the halogenated aromatic hydrocarbons, which are known for their diverse applications in pharmaceuticals, agrochemicals, and materials science. The presence of multiple halogen substituents, specifically bromine and fluorine, can significantly influence the compound's reactivity, stability, and solubility. Typically, such compounds exhibit interesting electronic properties due to the electronegative nature of the halogens, which can affect their interaction with biological systems and their potential environmental impact. Additionally, the presence of the bromopropyl group may impart unique physical properties, such as increased hydrophobicity. Overall, 2-Bromo-4-(3-bromopropyl)-1-fluorobenzene is a complex molecule with potential utility in various chemical applications.
Formula:C9H9Br2F
InChI:InChI=1S/C9H9Br2F/c10-5-1-2-7-3-4-9(12)8(11)6-7/h3-4,6H,1-2,5H2
InChI key:InChIKey=WISGEEYXCIMLQB-UHFFFAOYSA-N
SMILES:C(CCBr)C1=CC(Br)=C(F)C=C1
Synonyms:
  • Benzene, 2-bromo-4-(3-bromopropyl)-1-fluoro-
  • 2-Bromo-4-(3-bromopropyl)-1-fluorobenzene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.