CAS 1057678-67-7
:4-Bromo-1-(3-bromopropyl)-2-fluorobenzene
Description:
4-Bromo-1-(3-bromopropyl)-2-fluorobenzene is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with bromine and fluorine atoms, as well as a propyl chain that is also brominated. The presence of the bromine and fluorine substituents contributes to its reactivity and potential applications in various chemical reactions, including nucleophilic substitutions and cross-coupling reactions. This compound is likely to exhibit moderate to high lipophilicity due to the halogen substituents, which can influence its solubility in organic solvents. Additionally, the bromine atoms can enhance the compound's ability to participate in electrophilic aromatic substitution reactions. The presence of the fluorine atom may also impart unique electronic properties, affecting the compound's reactivity and stability. As with many halogenated compounds, 4-Bromo-1-(3-bromopropyl)-2-fluorobenzene may pose environmental and health risks, necessitating careful handling and disposal in accordance with safety regulations.
Formula:C9H9Br2F
InChI:InChI=1S/C9H9Br2F/c10-5-1-2-7-3-4-8(11)6-9(7)12/h3-4,6H,1-2,5H2
InChI key:InChIKey=VXTDJSZETOWXRX-UHFFFAOYSA-N
SMILES:C(CCBr)C1=C(F)C=C(Br)C=C1
Synonyms:- 4-Bromo-1-(3-bromopropyl)-2-fluorobenzene
- Benzene, 4-bromo-1-(3-bromopropyl)-2-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
