
CAS 1057679-72-7
:2-Bromo-5-fluorobenzenepropanamine
Description:
2-Bromo-5-fluorobenzenepropanamine is an organic compound characterized by its aromatic structure, which includes a bromine and a fluorine substituent on a benzene ring. The presence of the propanamine group indicates that it contains an amine functional group, which can participate in hydrogen bonding and influence its reactivity and solubility. This compound is likely to exhibit moderate polarity due to the electronegative halogen atoms and the amine group, affecting its interactions with other molecules. The bromine atom may impart certain reactivity, making it a potential candidate for nucleophilic substitution reactions. Additionally, the fluorine atom can enhance the compound's stability and influence its electronic properties. As with many halogenated compounds, 2-Bromo-5-fluorobenzenepropanamine may have applications in pharmaceuticals or agrochemicals, but its specific uses would depend on further studies regarding its biological activity and toxicity. Safety precautions should be taken when handling this compound due to the presence of halogens and the amine functional group.
Formula:C9H11BrFN
InChI:InChI=1S/C9H11BrFN/c10-9-4-3-8(11)6-7(9)2-1-5-12/h3-4,6H,1-2,5,12H2
InChI key:InChIKey=GNXBCQYHHVDEFJ-UHFFFAOYSA-N
SMILES:C(CCN)C1=C(Br)C=CC(F)=C1
Synonyms:- Benzenepropanamine, 2-bromo-5-fluoro-
- 2-Bromo-5-fluorobenzenepropanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.