
CAS 105776-12-3
:4,6-Dimethoxy-2-methyl-1H-indole
Description:
4,6-Dimethoxy-2-methyl-1H-indole is an organic compound belonging to the indole family, characterized by its bicyclic structure that includes a fused benzene and pyrrole ring. This compound features two methoxy groups (-OCH3) at the 4 and 6 positions and a methyl group (-CH3) at the 2 position of the indole ring, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to its hydrophobic nature. The presence of methoxy groups can influence its reactivity, making it a potential candidate for various chemical reactions, including methylation and alkylation. Additionally, compounds of this type may exhibit biological activity, making them of interest in medicinal chemistry and pharmacology. The CAS number 105776-12-3 uniquely identifies this substance in chemical databases, facilitating research and regulatory compliance. As with many indole derivatives, its properties can be further explored in the context of its synthesis, reactivity, and potential applications in drug development or materials science.
Formula:C11H13NO2
InChI:InChI=1S/C11H13NO2/c1-7-4-9-10(12-7)5-8(13-2)6-11(9)14-3/h4-6,12H,1-3H3
InChI key:InChIKey=XLXDVFVOFZYVGE-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(=CC(OC)=C1)NC(C)=C2
Synonyms:- 4,6-Dimethoxy-2-methyl-1H-indole
- 1H-Indole, 4,6-dimethoxy-2-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.