CymitQuimica logo

CAS 105782-53-4

:

TETRAKIS(OCTADECYLTHIO)TETRATHIAFULVALENE

Description:
Tetrakis(octadecylthio)tetrathiafulvalene (TTF) is a complex organic compound known for its unique electronic properties, primarily due to its tetrathiafulvalene core, which is a well-studied electron donor in organic chemistry. The presence of octadecylthio groups enhances its solubility in organic solvents and contributes to its stability, making it suitable for various applications in organic electronics and materials science. This compound exhibits interesting redox behavior, allowing it to participate in charge transfer processes, which is significant in the development of organic semiconductors and conductive materials. Its molecular structure typically features a central tetrathiafulvalene unit flanked by long alkyl chains, which influence its packing and intermolecular interactions. TTF derivatives are often explored in the context of organic photovoltaics, field-effect transistors, and molecular conductors. Additionally, the compound's properties can be affected by factors such as temperature and the presence of other materials, making it a subject of ongoing research in the field of organic electronics.
Formula:C78H148S8
InChI:InChI=1/C78H148S8/c1-5-9-13-17-21-25-29-33-37-41-45-49-53-57-61-65-69-79-73-74(80-70-66-62-58-54-50-46-42-38-34-30-26-22-18-14-10-6-2)84-77(83-73)78-85-75(81-71-67-63-59-55-51-47-43-39-35-31-27-23-19-15-11-7-3)76(86-78)82-72-68-64-60-56-52-48-44-40-36-32-28-24-20-16-12-8-4/h5-72H2,1-4H3
SMILES:CCCCCCCCCCCCCCCCCCSC1=C(SCCCCCCCCCCCCCCCCCC)SC(=C2SC(=C(SCCCCCCCCCCCCCCCCCC)S2)SCCCCCCCCCCCCCCCCCC)S1
Synonyms:
  • Tetrakis(Octadecylthio)Tetratihiafulvalene
  • Todt-Ttf
  • Tetrakis(octadecylthio)tetrathiafulvalene [Organic Electronic Material]
  • 2-[4,5-Bis(Octadecylsulfanyl)-1,3-Dithiol-2-Ylidene]-4,5-Bis(Octadecylsulfanyl)-1,3-Dithiole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.