CAS 105784-82-5
:3'-azido-2',3'-dideoxy-5-bromouridine
Description:
3'-Azido-2',3'-dideoxy-5-bromouridine is a nucleoside analog that exhibits unique structural and chemical characteristics. It is derived from uridine, with modifications that include the presence of an azido group at the 3' position and a bromine atom at the 5' position. This compound is notable for its potential antiviral properties, particularly against retroviruses, due to its ability to interfere with viral replication processes. The azido group enhances its reactivity and can facilitate incorporation into viral RNA, while the dideoxy modification prevents further elongation of the nucleic acid chain. The compound is typically studied in the context of medicinal chemistry and virology, where its efficacy and mechanism of action are explored. Additionally, its structural features contribute to its solubility and stability, making it a subject of interest in drug development. Overall, 3'-azido-2',3'-dideoxy-5-bromouridine represents a significant compound in the field of antiviral research.
Formula:C9H10BrN5O4
InChI:InChI=1/C9H10BrN5O4/c10-4-2-15(9(18)12-8(4)17)7-1-5(13-14-11)6(3-16)19-7/h2,5-7,16H,1,3H2,(H,12,17,18)/t5-,6+,7+/m0/s1
Synonyms:- Azbdurd
- Uridine, 3'-azido-5-bromo-2',3'-dideoxy-
- 3'-Azido-5-Bromo-2',3'-Dideoxyuridine
- 3'-Azido-2',3'-dideoxy-5-bromouridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.