CAS 10579-67-6
:3-chloro-1-(3,4-dihydroisoquinolin-2(1H)-yl)propan-1-one
Description:
3-Chloro-1-(3,4-dihydroisoquinolin-2(1H)-yl)propan-1-one, with the CAS number 10579-67-6, is a chemical compound that features a chloro substituent and a dihydroisoquinoline moiety. This compound typically exhibits characteristics common to both ketones and aromatic heterocycles. The presence of the chloro group suggests potential reactivity in nucleophilic substitution reactions, while the dihydroisoquinoline structure may contribute to its biological activity, possibly influencing its interaction with various biological targets. The compound is likely to be a solid at room temperature, with moderate solubility in organic solvents due to its polar functional groups. Its molecular structure indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, given the importance of isoquinoline derivatives in drug discovery. Additionally, the compound's reactivity and stability can be influenced by factors such as pH and temperature, which are critical for its handling and storage in laboratory settings.
Formula:C12H14ClNO
InChI:InChI=1/C12H14ClNO/c13-7-5-12(15)14-8-6-10-3-1-2-4-11(10)9-14/h1-4H,5-9H2
SMILES:c1ccc2CN(CCc2c1)C(=O)CCCl
Synonyms:- 2-(3-Chloropropanoyl)-1,2,3,4-Tetrahydroisoquinoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
