CymitQuimica logo

CAS 10579-68-7

:

1,2,3,4-Tetrahydro-6,7-dimethylquinoxaline

Description:
1,2,3,4-Tetrahydro-6,7-dimethylquinoxaline is a bicyclic organic compound belonging to the quinoxaline family, characterized by its fused aromatic and saturated rings. This compound features a tetrahydro structure, indicating the presence of four hydrogen atoms that saturate the nitrogen-containing ring system. The dimethyl substitutions at the 6 and 7 positions contribute to its unique chemical properties, influencing its reactivity and potential biological activity. It is typically a colorless to pale yellow liquid or solid, depending on the specific conditions and purity. The compound is of interest in medicinal chemistry and pharmacology due to its potential applications in developing therapeutic agents. Its molecular structure allows for various interactions with biological targets, making it a subject of research in neuropharmacology and other fields. Additionally, it may exhibit specific solubility characteristics and stability under various conditions, which are essential for its practical applications in synthesis and formulation. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C10H14N2
InChI:InChI=1S/C10H14N2/c1-7-5-9-10(6-8(7)2)12-4-3-11-9/h5-6,11-12H,3-4H2,1-2H3
InChI key:InChIKey=DPSZEBZGBCWUBN-UHFFFAOYSA-N
SMILES:CC=1C=C2C(=CC1C)NCCN2
Synonyms:
  • 1,2,3,4-Tetrahydro-6,7-dimethylquinoxaline
  • Quinoxaline, 1,2,3,4-tetrahydro-6,7-dimethyl-
  • 6,7-Dimethyl-1,2,3,4-tetrahydroquinoxaline
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.