CymitQuimica logo

CAS 105799-70-0

:

ETHYL 8-FLUORO-4H-(1)-BENZOPYRANO(4 3-B&

Description:
Ethyl 8-fluoro-4H-(1)-benzopyrano(4,3-b)quinolin-4-one, identified by the CAS number 105799-70-0, is a synthetic organic compound that belongs to the class of benzopyran derivatives. This compound features a fused bicyclic structure that incorporates both a benzopyran and a quinoline moiety, which contributes to its potential biological activity. The presence of the fluorine atom at the 8-position can influence the compound's electronic properties and lipophilicity, potentially enhancing its pharmacological profile. Ethyl groups are typically associated with increased solubility and stability in organic solvents. Compounds of this nature are often investigated for their potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. The specific characteristics, such as melting point, solubility, and reactivity, would depend on the compound's molecular structure and functional groups. As with many synthetic organic compounds, safety data and handling precautions should be considered when working with this substance in a laboratory setting.
Formula:C14H11FO3S
InChI:InChI=1/C14H11FO3S/c1-2-17-14(16)12-5-8-7-18-11-4-3-9(15)6-10(11)13(8)19-12/h3-6H,2,7H2,1H3
SMILES:CCOC(=O)c1cc2COc3ccc(cc3c2s1)F
Synonyms:
  • ethyl 8-fluoro-4H-thieno[3,2-c]chromene-2-carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.