CAS 10580-65-1
:2-[(Nonyloxy)methyl]oxirane
Description:
2-[(Nonyloxy)methyl]oxirane, also known as a nonyl glycidyl ether, is an organic compound characterized by the presence of an epoxide functional group, which is a three-membered cyclic ether. This compound features a nonyl group, indicating a long hydrophobic alkyl chain, which contributes to its surfactant properties and potential applications in various formulations. The presence of the oxirane ring suggests that it can undergo ring-opening reactions, making it reactive and useful in polymer chemistry and as a building block for more complex molecules. Its structure allows for compatibility with both polar and nonpolar substances, enhancing its utility in emulsions and coatings. Additionally, the compound may exhibit low volatility and moderate solubility in organic solvents, which can influence its behavior in different chemical environments. Safety data should be consulted for handling, as compounds with similar structures may pose health risks. Overall, 2-[(Nonyloxy)methyl]oxirane is significant in industrial applications, particularly in the production of surfactants and as a reactive intermediate in organic synthesis.
Formula:C12H24O2
InChI:InChI=1S/C12H24O2/c1-2-3-4-5-6-7-8-9-13-10-12-11-14-12/h12H,2-11H2,1H3
InChI key:InChIKey=KEKXMAURKVLACV-UHFFFAOYSA-N
SMILES:C(OCCCCCCCCC)C1CO1
Synonyms:- Nonyl glycidyl ether
- Propane, 1,2-epoxy-3-(nonyloxy)-
- ((Nonyloxy)methyl)oxirane
- Oxirane, 2-[(nonyloxy)methyl]-
- Oxirane, [(nonyloxy)methyl]-
- 2-[(Nonyloxy)methyl]oxirane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Nonyl Glycidyl Ether
CAS:Controlled ProductFormula:C12H24O2Color and Shape:NeatMolecular weight:200.318

