CymitQuimica logo

CAS 105806-13-1

:

4,6-dichloro-5-fluoro-2-methylpyrimidine

Description:
4,6-Dichloro-5-fluoro-2-methylpyrimidine is a heterocyclic organic compound characterized by a pyrimidine ring substituted with two chlorine atoms, one fluorine atom, and a methyl group. The presence of these halogen substituents significantly influences its chemical reactivity and physical properties. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents. It is primarily utilized in the pharmaceutical industry as an intermediate in the synthesis of various bioactive compounds, particularly in the development of agrochemicals and pharmaceuticals. The halogen atoms contribute to its potential as a building block for further chemical modifications, enhancing its utility in medicinal chemistry. Additionally, the compound's structure suggests potential biological activity, making it of interest for research in drug development. Safety data indicates that, like many halogenated compounds, it should be handled with care due to potential toxicity and environmental concerns. Proper storage and disposal methods are essential to mitigate any risks associated with its use.
Formula:C5H3Cl2FN2
InChI:InChI=1/C5H3Cl2FN2/c1-2-9-4(6)3(8)5(7)10-2/h1H3
InChI key:IWPZWKNMDQSDQP-UHFFFAOYSA-N
SMILES:Cc1nc(c(c(Cl)n1)F)Cl
Synonyms:
  • Pyrimidine, 4,6-Dichloro-5-Fluoro-2-Methyl-
Found 4 products.