CAS 105809-15-2
:1,1,3,3,5,5-hexakis(deuteriomethyl)-2,4,6-triaza-1$l^{5},3$l^{5},5$l^{5}-triphosphacyclohexa-1,3,5-triene
Description:
1,1,3,3,5,5-hexakis(deuteriomethyl)-2,4,6-triaza-1$l^{5},3$l^{5},5$l^{5}-triphosphacyclohexa-1,3,5-triene is a complex chemical compound characterized by its unique structure, which includes a cyclohexa-1,3,5-triene framework integrated with three nitrogen atoms and three phosphorus atoms. The presence of deuteriomethyl groups indicates that hydrogen atoms in the methyl groups are replaced by deuterium, a stable isotope of hydrogen, which can influence the compound's physical and chemical properties, such as its mass and reactivity. This compound is likely to exhibit interesting coordination chemistry due to the presence of phosphorus and nitrogen, which can participate in various bonding interactions. Its unique structure may also impart specific electronic properties, making it of interest in fields such as materials science and catalysis. The compound's CAS number, 105809-15-2, allows for precise identification and retrieval of information in chemical databases, facilitating research and application in various scientific domains.
Formula:C6H12D6N3P3
InChI:InChI=1/C6H18N3P3/c1-10(2)7-11(3,4)9-12(5,6)8-10/h1-6H3/i1D,2D,3D,4D,5D,6D
SMILES:C(P1(=NP(=NP(=N1)(C[2H])C[2H])(C[2H])C[2H])C[2H])[2H]
Synonyms:- 2,2,4,4,6,6-Hexakis[(2
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Ultramark∣r 1621, Mass Spec Std
CAS:<p>Ultramark 1621 is used as a reference compound for positive and negative ion fast-atom bombardment high-resolution mass spectrometry. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.</p>Formula:C6H18N3P3Color and Shape:Clear or slightly hazy, yellow, LiquidMolecular weight:225.15Ultramark 1621
CAS:Controlled Product<p>Applications Ultramark 1621, a commercially available mixture of fluorinated phosphazines, is a useful calibration compound for negative and positive ion fast-atom bombardment (FAB) high-resolution mass spectrometry.<br>References Jiang, L., et al.: J. Am. Soc. Mass Spec., 3, 842 (1992)<br></p>Formula:C6H6H12N3P3Color and Shape:NeatMolecular weight:231.19




