CymitQuimica logo

CAS 10583-83-2

:

1-ETHYL-1H-IMIDAZOLE-2-THIOL

Description:
1-Ethyl-1H-imidazole-2-thiol is a heterocyclic organic compound characterized by its imidazole ring structure, which contains both nitrogen and sulfur atoms. This compound features an ethyl group attached to the nitrogen atom of the imidazole ring and a thiol (-SH) functional group at the 2-position. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the thiol group imparts distinct chemical properties, including the ability to form disulfide bonds and participate in redox reactions. 1-Ethyl-1H-imidazole-2-thiol is known for its potential applications in various fields, including pharmaceuticals, where it may serve as a building block for drug synthesis or as a ligand in coordination chemistry. Additionally, its unique structure allows it to interact with biological systems, making it of interest in biochemical research. Safety data should be consulted for handling and storage, as thiols can be malodorous and may pose health risks if not managed properly.
Formula:C5H8N2S
InChI:InChI=1/C5H8N2S/c1-2-7-4-3-6-5(7)8/h3-4H,2H2,1H3,(H,6,8)
SMILES:CCn1ccnc1S
Synonyms:
  • 1-ethyl-1,3-dihydro-2H-imidazole-2-thione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.