CAS 105842-89-5

Acetamide, N-[2-[4-(2-chloro-1-oxopropyl)phenyl]ethyl]-

Description:

Acetamide, N-[2-[4-(2-chloro-1-oxopropyl)phenyl]ethyl]- is an organic compound characterized by its amide functional group, which is derived from acetic acid. This compound features a phenyl ring substituted with a chloro group and a propyl chain, indicating potential biological activity or applications in pharmaceuticals. The presence of the chloro substituent suggests that it may exhibit unique reactivity or interaction with biological targets. The molecular structure implies that it could participate in hydrogen bonding due to the amide group, influencing its solubility and melting point. Additionally, the compound's specific arrangement of atoms may contribute to its overall polarity and lipophilicity, which are critical factors in drug design and development. As with many organic compounds, its stability, reactivity, and potential toxicity would need to be assessed in the context of its intended use. Overall, this compound's characteristics make it a subject of interest in medicinal chemistry and related fields.

Formula: C₁₃H₁₆ClNO₂

InChI: InChI=1S/C13H16ClNO2/c1-9(14)13(17)12-5-3-11(4-6-12)7-8-15-10(2)16/h3-6,9H,7-8H2,1-2H3,(H,15,16)

InChI key: InChIKey=KVZIMDNIVVWTAC-UHFFFAOYSA-N

SMILES: C(C(C)Cl)(=O)C1=CC=C(CCNC(C)=O)C=C1

Synonyms:

• N-[2-[4-(2-Chloro-1-oxopropyl)phenyl]ethyl]acetamide
• Acetamide, N-[2-[4-(2-chloro-1-oxopropyl)phenyl]ethyl]-

N-{2-[4-(2-Chloropropanoyl)phenyl]ethyl}acetamide

CAS: 105842-89-5

Versatile small molecule scaffold

Formula: C₁₃H₁₆ClNO₂

Purity: Min. 95%

Molecular weight: 253.72 g/mol

Ref: 3D-FEA84289