CymitQuimica logo

CAS 105843-36-5

:

1-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-nitro-4,5-dihydro-1H-imidazol-2-amine

Description:
1-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-nitro-4,5-dihydro-1H-imidazol-2-amine, with the CAS number 105843-36-5, is a chemical compound characterized by its complex structure, which includes a thiazole ring and an imidazole moiety. This compound features a nitro group, which is known for its potential reactivity and influence on the compound's biological activity. The presence of the chlorine atom in the thiazole ring contributes to its unique chemical properties, potentially affecting its solubility and reactivity. The imidazole portion of the molecule is often associated with biological activity, making this compound of interest in medicinal chemistry. Its specific characteristics, such as melting point, solubility, and stability, can vary based on environmental conditions and the presence of other substances. Overall, this compound may exhibit pharmacological properties, making it a candidate for further research in drug development and therapeutic applications.
Formula:C7H8ClN5O2S
InChI:InChI=1/C7H8ClN5O2S/c8-6-10-3-5(16-6)4-12-2-1-9-7(12)11-13(14)15/h3H,1-2,4H2,(H,9,11)
InChI key:OWRSHPAYDYCHSJ-UHFFFAOYSA-N
SMILES:C1CN(Cc2cnc(Cl)s2)C(=N1)NN(=O)=O
Found 12 products.