CAS 105856-26-6

(1,2-bis(4-fluorophenyl)ethylenediamine)dichloroplatinum(II)

Description:

(1,2-bis(4-fluorophenyl)ethylenediamine)dichloroplatinum(II), with the CAS number 105856-26-6, is a coordination compound featuring platinum as the central metal ion. This compound is characterized by its coordination with a bidentate ligand, specifically 1,2-bis(4-fluorophenyl)ethylenediamine, which contains two aromatic rings substituted with fluorine atoms. The presence of the dichloride indicates that two chloride ions are coordinated to the platinum center, contributing to its overall stability and reactivity. This compound is of interest in medicinal chemistry, particularly in the development of anticancer agents, due to its potential to interact with biological macromolecules. Its structural features may influence its solubility, biological activity, and mechanism of action. Additionally, the fluorine substituents can enhance the lipophilicity and metabolic stability of the compound, making it a subject of study in drug design. Overall, this platinum complex exemplifies the intersection of inorganic chemistry and pharmacology, showcasing the importance of metal coordination in therapeutic applications.

Formula: C₁₄H₁₄Cl₂F₂N₂Pt

InChI: InChI=1/C14H14F2N2.2ClH.Pt/c15-11-5-1-9(2-6-11)13(17)14(18)10-3-7-12(16)8-4-10;;;/h1-8,13-14H,17-18H2;2*1H;/q;;;+2/p-2

SMILES: c1cc(ccc1C(C(c1ccc(cc1)F)N)N)F.Cl.Cl.[Pt]

Synonyms:

• 1,2-Bfpedp
• Platinum, (1,2-bis(4-fluorophenyl)-1,2-ethanediamine-N,N')dichloro-, (SP-4-2-(R*,R*))-
• Platinum(2+) Chloride 1,2-Bis(4-Fluorophenyl)Ethane-1,2-Diamine (1:2:1)
• (1,2-Bis(4-fluorophenyl)ethylenediamine)dichloroplatinum(II)