CAS 105859-45-8
:(2S)-3-{[tert-butyl(dimethyl)silyl]oxy}-2-methylpropan-1-ol
Description:
The chemical substance known as (2S)-3-{[tert-butyl(dimethyl)silyl]oxy}-2-methylpropan-1-ol, with the CAS number 105859-45-8, is an organic compound characterized by its chiral center, which imparts specific stereochemical properties. This compound features a tert-butyl(dimethyl)silyl group, which enhances its stability and solubility in organic solvents, making it useful in various synthetic applications. The presence of the hydroxyl (-OH) group indicates that it is an alcohol, contributing to its reactivity and potential for hydrogen bonding. The structure suggests that it may be involved in reactions typical of alcohols, such as dehydration or substitution reactions. Additionally, the tert-butyl group provides steric hindrance, which can influence the compound's reactivity and interactions with other molecules. Overall, this compound is significant in organic synthesis and may serve as a precursor or intermediate in the preparation of more complex molecules in pharmaceutical or materials chemistry.
Formula:C10H24O2Si
InChI:InChI=1/C10H24O2Si/c1-9(7-11)8-12-13(5,6)10(2,3)4/h9,11H,7-8H2,1-6H3/t9-/m0/s1
SMILES:C[C@@H](CO)CO[Si](C)(C)C(C)(C)C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(2S)-3-{[tert-Butyl(dimethyl)silyl]oxy}-2-methylpropan-1-ol
CAS:Controlled ProductApplications (2S)-3-{[tert-Butyl(dimethyl)silyl]oxy}-2-methylpropan-1-ol (cas# 105859-45-8) is a compound useful in organic synthesis.
Formula:C10H24O2SiColor and Shape:NeatMolecular weight:204.38
