CymitQuimica logo

CAS 105864-79-7

:

bis(trifluoroethyl)carbamodithioic acid

Description:
Bis(trifluoroethyl)carbamodithioic acid is a chemical compound characterized by its unique structure, which includes two trifluoroethyl groups attached to a central carbamodithioic acid moiety. This compound is notable for its high degree of fluorination, which imparts distinct physical and chemical properties, such as increased stability and hydrophobicity. The presence of the dithioic acid functional group suggests that it may exhibit strong chelating abilities, potentially interacting with metal ions. Its trifluoroethyl groups contribute to its volatility and low surface tension, making it useful in various applications, including as a reagent in organic synthesis and potentially in agrochemical formulations. The compound is typically handled with care due to the presence of fluorinated groups, which can pose environmental and health concerns. Overall, bis(trifluoroethyl)carbamodithioic acid is a specialized chemical with applications in research and industry, particularly in fields that require fluorinated compounds.
Formula:C5H5F6NS2
InChI:InChI=1/C5H5F6NS2/c6-4(7,8)1-12(3(13)14)2-5(9,10)11/h1-2H2,(H,13,14)
SMILES:C(C(F)(F)F)N(CC(F)(F)F)C(=S)S
Synonyms:
  • Bis(trifluoroethyl) dithiocarbamate
  • Lithium bis(trifluoroethyl)dithiocarbamate
  • Carbamodithioic acid, bis(trifluoroethyl)-
  • Bis(2,2,2-Trifluoroethyl)Carbamodithioic Acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.