CAS 105868-34-6
:7,7'-DIMETHOXY-[4,4']BI[BENZO[1,3]DIOXOLYL]-5,5'-DICARBOXYLIC ACID
Description:
7,7'-Dimethoxy-[4,4']bi[benzo[1,3]dioxolyl]-5,5'-dicarboxylic acid is a complex organic compound characterized by its unique structural features, including two methoxy groups and dicarboxylic acid functionalities. This compound belongs to a class of organic molecules known for their potential applications in pharmaceuticals, materials science, and organic synthesis. The presence of the benzo[1,3]dioxole moiety contributes to its aromatic properties, which can influence its reactivity and solubility. The dicarboxylic acid groups provide sites for potential hydrogen bonding and reactivity, making it versatile for various chemical reactions. Additionally, the methoxy substituents can enhance the compound's solubility in organic solvents and may influence its electronic properties. Overall, this compound's structural complexity and functional groups suggest potential utility in research and development, particularly in the fields of medicinal chemistry and organic materials. However, specific applications and biological activities would require further investigation through empirical studies.
Formula:C18H14O10
InChI:InChI=1/C18H14O10/c1-23-9-3-7(17(19)20)11(15-13(9)25-5-27-15)12-8(18(21)22)4-10(24-2)14-16(12)28-6-26-14/h3-4H,5-6H2,1-2H3,(H,19,20)(H,21,22)
SMILES:COc1cc(c(c2c(cc(c3c2OCO3)OC)C(=O)O)c2c1OCO2)C(=O)O
Synonyms:- [4,4'-Bi-1,3-benzodioxole]-5,5'-dicarboxylic acid, 7,7'-dimethoxy-
- 7,7'-Dimethoxy-4,4'-bi-1,3-benzodioxole-5,5'-dicarboxylic acid
- Bifendate Impurity 1
- 7,7'-dimethoxy-[4,4'-bibenzo[d][1,3]dioxole]-5,5'-dicarboxylic acid
- 4-(5-carboxy-7-methoxy-1,3-benzodioxol-4-yl)-7-methoxy-1,3-benzodioxole-5-carboxylic acid
- Bifendate Impurity 4
- 7,7'-Dimethoxy-[4,4'-bibenzo[d][1,3]dioxole]-5,5'-dicarboxylic acid
- Bicyclol Impurity C
- Bifendate Dicarboxylic Acid
- Bicyclic alcohol impurity F
- Bifendate Impurity 3
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
7,7'-Dimethoxy-[4,4']bi[benzo[1,3]dioxolyl]-5,5'-dicarboxylic acid
CAS:Formula:C18H14O10Purity:95%Color and Shape:SolidMolecular weight:390.29787,7'-Dimethoxy-[4,4']bi[benzo[1,3]dioxolyl]-5,5'-dicarboxylic acid
CAS:Purity:97.0%Molecular weight:390.29998779296875Bifendate Dicarboxylic Acid
CAS:Controlled ProductApplications Carboxylic acid derivative of Bifendate (B382890), a synthetic intermediate of Schisandrin C and also a anti-HBV drug used in the treatment of chronic hepatitis B.
References Pan, S.Y., et al.: Euro. J. Pharmacol. 522, 170 (2006); Zeng, Y., et al.: Acta. Pharmacol. Sinica., 30, 478 (2009);Formula:C18H14O10Color and Shape:NeatMolecular weight:390.3


