CymitQuimica logo

CAS 1058707-01-9

:

Cyclohexane, 3-ethenyl-1,1-dimethyl-

Description:
Cyclohexane, 3-ethenyl-1,1-dimethyl- is an organic compound characterized by a cyclohexane ring substituted with an ethenyl group and two methyl groups. This compound belongs to the class of alkenes due to the presence of a double bond in the ethenyl group. Its molecular structure contributes to its unique physical and chemical properties, including a relatively low boiling point and moderate solubility in organic solvents. The presence of the double bond makes it more reactive than saturated hydrocarbons, allowing it to participate in various chemical reactions such as polymerization and addition reactions. Additionally, the steric hindrance introduced by the two methyl groups can influence its reactivity and stability. Cyclohexane derivatives are often used in the synthesis of more complex organic molecules and can serve as intermediates in various chemical processes. Safety considerations should be taken into account when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C10H18
InChI:InChI=1S/C10H18/c1-4-9-6-5-7-10(2,3)8-9/h4,9H,1,5-8H2,2-3H3
InChI key:InChIKey=LBOSNFCETLPKKR-UHFFFAOYSA-N
SMILES:C(=C)C1CC(C)(C)CCC1
Synonyms:
  • Cyclohexane, 3-ethenyl-1,1-dimethyl-
  • 3-Ethenyl-1,1-dimethylcyclohexane
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.