CAS 105891-55-2

1,30-Diphenyl-2,5,8,11,14,17,20,23,26,29-decaoxatriacontane

Description:

1,30-Diphenyl-2,5,8,11,14,17,20,23,26,29-decaoxatriacontane is a long-chain organic compound characterized by its extensive carbon backbone and multiple ether linkages. This substance features a triacontane structure, which consists of 30 carbon atoms, and is substituted with two phenyl groups at the 1 and 30 positions. The presence of multiple ether groups contributes to its unique chemical properties, including potential solubility in organic solvents and varying degrees of hydrophobicity. The compound's long carbon chain and phenyl substituents may impart interesting physical properties, such as melting and boiling points, as well as potential applications in materials science, particularly in the development of surfactants or polymer additives. Additionally, the presence of multiple oxygen atoms in the form of ether linkages suggests that it may exhibit different reactivity compared to typical hydrocarbons, potentially influencing its interactions in various chemical environments. Overall, this compound represents a complex structure with potential utility in various chemical and industrial applications.

Formula: C₃₂H₅₀O₁₀

InChI: InChI=1S/C32H50O10/c1-3-7-31(8-4-1)29-41-27-25-39-23-21-37-19-17-35-15-13-33-11-12-34-14-16-36-18-20-38-22-24-40-26-28-42-30-32-9-5-2-6-10-32/h1-10H,11-30H2

InChI key: InChIKey=URGNUQPRIFVALO-UHFFFAOYSA-N

SMILES: C(OCCOCCOCCOCCOCCOCCOCCOCCOCCOCC1=CC=CC=C1)C2=CC=CC=C2

Synonyms:

• 2,5,8,11,14,17,20,23,26,29-Decaoxatriacontane, 1,30-diphenyl-
• 1,30-Diphenyl-2,5,8,11,14,17,20,23,26,29-decaoxatriacontane

2,5,8,11,14,17,20,23,26,29-Decaoxatriacontane, 1,30-diphenyl-

CAS: 105891-55-2

Formula: C₃₂H₅₀O₁₀

Molecular weight: 594.7333999999997

Ref: IN-DA007EQ4