CAS 105906-34-1

2-[(2-Chlorophenyl)thio]-3-pentanone

Description:

2-[(2-Chlorophenyl)thio]-3-pentanone, with the CAS number 105906-34-1, is an organic compound characterized by its thioether functional group and a ketone moiety. This compound features a pentanone backbone, which indicates the presence of a ketone functional group at the third carbon position, while a 2-chlorophenyl group is attached via a sulfur atom, contributing to its thioether characteristics. The presence of the chlorine atom on the phenyl ring can influence the compound's reactivity, polarity, and overall chemical behavior. Typically, compounds of this nature exhibit moderate to low solubility in water due to their hydrophobic hydrocarbon chains, while being more soluble in organic solvents. The thioether linkage may also impart unique properties, such as increased stability and potential for nucleophilic substitution reactions. Additionally, the compound may have applications in organic synthesis, pharmaceuticals, or as an intermediate in various chemical processes, although specific applications would depend on further research and development.

Formula: C₁₁H₁₃ClOS

InChI: InChI=1S/C11H13ClOS/c1-3-10(13)8(2)14-11-7-5-4-6-9(11)12/h4-8H,3H2,1-2H3

InChI key: InChIKey=DXIUSTAGEBAFIA-UHFFFAOYSA-N

SMILES: S(C(C(CC)=O)C)C1=C(Cl)C=CC=C1

Synonyms:

• 3-Pentanone, 2-[(2-chlorophenyl)thio]-
• 2-(2-Chloro-phenylsulfanyl)-pentan-3-one
• 2-[(2-Chlorophenyl)sulfanyl]pentan-3-one
• 2-[(2-Chlorophenyl)thio]-3-pentanone
• 3-Pentanone, 2-(o-chlorophenylthio)-