CAS 105906-98-7

3-Pyrrolidinone, 1-methyl-2-phenyl-

Description:

3-Pyrrolidinone, 1-methyl-2-phenyl- is a chemical compound characterized by its pyrrolidinone ring structure, which features a nitrogen atom within a five-membered lactam. This compound typically exhibits properties associated with both amides and cyclic compounds, including moderate polarity and potential solubility in organic solvents. The presence of the methyl and phenyl groups contributes to its unique chemical behavior, influencing its reactivity and interaction with other substances. It may serve as an intermediate in organic synthesis or as a building block in the development of pharmaceuticals and agrochemicals. Additionally, the compound's structure suggests potential applications in materials science, particularly in the formulation of polymers or coatings. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance, to ensure proper precautions are taken during use. Overall, 3-Pyrrolidinone, 1-methyl-2-phenyl- is a versatile compound with potential applications across various fields of chemistry.

Formula: C₁₁H₁₃NO

InChI: InChI=1S/C11H13NO/c1-12-8-7-10(13)11(12)9-5-3-2-4-6-9/h2-6,11H,7-8H2,1H3

InChI key: InChIKey=XMCKBNIWHCGNIA-UHFFFAOYSA-N

SMILES: O=C1C(N(C)CC1)C2=CC=CC=C2

Synonyms:

• 3-Pyrrolidinone, 1-methyl-2-phenyl-