CymitQuimica logo

CAS 105907-31-1

:

7-Chloro-1,2,3,4-tetrahydro-2,6-dimethylquinoline

Description:
7-Chloro-1,2,3,4-tetrahydro-2,6-dimethylquinoline is a heterocyclic organic compound characterized by its quinoline structure, which consists of a bicyclic system containing a benzene ring fused to a pyridine ring. This compound features a chlorine atom at the 7-position and two methyl groups at the 2 and 6 positions of the quinoline ring, contributing to its unique chemical properties. The tetrahydro configuration indicates that the compound has four hydrogen atoms added to the quinoline structure, resulting in a saturated form. This compound is of interest in medicinal chemistry due to its potential biological activities, including antimicrobial and anti-inflammatory properties. Its molecular structure allows for various interactions with biological targets, making it a candidate for further research in drug development. Additionally, the presence of the chlorine atom can influence its reactivity and solubility, which are important factors in pharmacokinetics. Overall, 7-Chloro-1,2,3,4-tetrahydro-2,6-dimethylquinoline represents a significant compound for exploration in both synthetic and medicinal chemistry.
Formula:C11H14ClN
InChI:InChI=1S/C11H14ClN/c1-7-5-9-4-3-8(2)13-11(9)6-10(7)12/h5-6,8,13H,3-4H2,1-2H3
InChI key:InChIKey=GTTBSKSOHRGXRD-UHFFFAOYSA-N
SMILES:ClC=1C=C2C(=CC1C)CCC(C)N2
Synonyms:
  • 7-Chloro-1,2,3,4-tetrahydro-2,6-dimethylquinoline
  • Quinoline, 7-chloro-1,2,3,4-tetrahydro-2,6-dimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.