CAS 105907-65-1

1-(3,5-Dimethylphenyl)piperazine

Description:

1-(3,5-Dimethylphenyl)piperazine is an organic compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The presence of a 3,5-dimethylphenyl group attached to the piperazine ring significantly influences its chemical properties and biological activity. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents, reflecting its hydrophobic characteristics due to the aromatic substituent. It may possess psychoactive properties, as piperazine derivatives are often studied for their effects on the central nervous system. The compound's molecular structure allows for potential interactions with various receptors, making it of interest in medicinal chemistry and pharmacology. Additionally, its synthesis involves standard organic reactions, including amination and alkylation processes. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity and environmental impact. Overall, 1-(3,5-Dimethylphenyl)piperazine serves as a valuable compound in research and development within the fields of chemistry and pharmacology.

Formula: C₁₂H₁₈N₂

InChI: InChI=1/C12H18N2/c1-10-7-11(2)9-12(8-10)14-5-3-13-4-6-14/h7-9,13H,3-6H2,1-2H3

SMILES: Cc1cc(C)cc(c1)N1CCNCC1

Synonyms:

• Piperazine, 1-(3,5-dimethylphenyl)-