CymitQuimica logo

CAS 105908-71-2

:

1-MONOBROMODIBENZO-P-DIOXIN

Description:
1-Monobromodibenzo-p-dioxin, with the CAS number 105908-71-2, is a halogenated organic compound belonging to the class of dioxins, which are known for their complex structures and potential environmental and health impacts. This compound features a dibenzo-p-dioxin core structure, characterized by two benzene rings connected by two oxygen atoms, with a bromine atom substituting one of the hydrogen atoms on the aromatic ring. The presence of the bromine atom can influence the compound's chemical reactivity, stability, and toxicity. Dioxins, including their brominated derivatives, are often persistent in the environment and can bioaccumulate in living organisms, leading to various adverse health effects, including endocrine disruption and carcinogenicity. The compound's physical properties, such as solubility and melting point, can vary based on its molecular structure and substituents. Due to its potential environmental and health risks, 1-monobromodibenzo-p-dioxin is subject to regulatory scrutiny and monitoring in various jurisdictions.
Formula:C12H7BrO2
InChI:InChI=1/C12H7BrO2/c13-8-4-3-7-11-12(8)15-10-6-2-1-5-9(10)14-11/h1-7H
SMILES:c1ccc2c(c1)Oc1cccc(c1O2)Br
Synonyms:
  • 1-Bromodibenzo-Para-Dioxin
  • 1-Monobromodibenzo-Para-Dioxin
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.