CAS 105909-12-4
:2,5-DIMETHYL-4-METHOXYPHENYLACETONITRILE
Description:
2,5-Dimethyl-4-methoxyphenylacetonitrile, with the CAS number 105909-12-4, is an organic compound characterized by its aromatic structure and functional groups. It features a phenyl ring substituted with two methyl groups and a methoxy group, contributing to its unique chemical properties. The presence of the acetonitrile functional group indicates that it contains a cyano group (-CN) attached to an acetyl moiety, which can influence its reactivity and solubility. This compound is typically a solid at room temperature and may exhibit moderate polarity due to the presence of the methoxy and cyano groups. Its synthesis often involves multi-step organic reactions, and it may be used in various applications, including pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Safety data should be consulted for handling, as compounds with nitrile groups can pose health risks. Overall, 2,5-dimethyl-4-methoxyphenylacetonitrile is a notable compound in organic chemistry with potential utility in various chemical applications.
Formula:C11H13NO
InChI:InChI=1/C11H13NO/c1-8-7-11(13-3)9(2)6-10(8)4-5-12/h6-7H,4H2,1-3H3
SMILES:Cc1cc(c(C)cc1CC#N)OC
Synonyms:- 2,5-Dimethyl-4-Cyano-Methylanisole
- (4-Methoxy-2,5-Dimethylphenyl)Acetonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2,5-Dimethyl-4-methoxyphenylacetonitrile
CAS:<p>2,5-Dimethyl-4-methoxyphenylacetonitrile</p>Molecular weight:175.22702g/mol


