CAS 105909-93-1
:5-methoxy-1,2-dimethyl-1H-indole-3-carboxylic acid
Description:
5-Methoxy-1,2-dimethyl-1H-indole-3-carboxylic acid is an indole derivative characterized by its unique structure, which includes a methoxy group and two methyl groups attached to the indole ring. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the methoxy group enhances its lipophilicity, potentially influencing its biological activity and solubility in organic solvents. Indole derivatives are known for their diverse pharmacological properties, including anti-inflammatory, antimicrobial, and anticancer activities. The specific arrangement of substituents in this compound may also affect its interaction with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's stability, reactivity, and potential applications in drug development can be influenced by its structural characteristics. Overall, 5-methoxy-1,2-dimethyl-1H-indole-3-carboxylic acid represents a significant compound for further research in both synthetic and medicinal chemistry contexts.
Formula:C12H13NO3
InChI:InChI=1/C12H13NO3/c1-7-11(12(14)15)9-6-8(16-3)4-5-10(9)13(7)2/h4-6H,1-3H3,(H,14,15)
SMILES:Cc1c(c2cc(ccc2n1C)OC)C(=O)O
Synonyms:- 1H-Indole-3-carboxylic acid, 5-methoxy-1,2-dimethyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
5-Methoxy-1,2-dimethyl-1H-indole-3-carboxylic acid
CAS:Formula:C12H13NO3Color and Shape:SolidMolecular weight:219.23655-Methoxy-1,2-dimethyl-1H-indole-3-carboxylic Acid
CAS:Controlled Product<p>Applications 5-methoxy-1,2-dimethyl-1H-indole-3-carboxylic acid (cas# 105909-93-1) is a useful research chemical.<br></p>Formula:C12H13NO3Color and Shape:NeatMolecular weight:219.245-Methoxy-1,2-dimethyl-1H-indole-3-carboxylic acid
CAS:Controlled Product<p>5-Methoxy-1,2-dimethyl-1H-indole-3-carboxylic acid is a compound that has been shown to inhibit the polymerization of polymers. This chemical can be used as a sealant due to its ability to form a protective film on surfaces. It is also an effective polymerization inhibitor for polymers such as polyvinyl chloride and polystyrene, which are both used in the production of solar cells. 5-Methoxy-1,2-dimethyl-1H-indole-3-carboxylic acid can also be used to enhance the performance of solar cells by preventing water vapor from degrading the polymers that they are made of. The optimal wavelength range for this chemical is between 200 and 400 nm.</p>Formula:C12H13NO3Purity:Min. 95%Molecular weight:219.24 g/mol


