CAS 1059175-55-1

(2E)-3-(3-Bromo-4-fluorophenyl)-2-propen-1-ol

Description:

(2E)-3-(3-Bromo-4-fluorophenyl)-2-propen-1-ol is an organic compound characterized by its structure, which features a propenol moiety with a bromine and a fluorine substituent on a phenyl ring. The presence of the double bond in the propenol structure contributes to its reactivity, making it a potential candidate for various chemical reactions, including electrophilic additions and polymerizations. The bromine atom introduces significant electronegativity, which can influence the compound's reactivity and interaction with other molecules. The fluorine substituent, known for its strong electron-withdrawing properties, can also affect the compound's overall polarity and solubility in different solvents. This compound may exhibit interesting biological activities due to its unique functional groups, making it a subject of interest in medicinal chemistry and material science. Its specific properties, such as melting point, boiling point, and solubility, would need to be determined through experimental methods or referenced from chemical databases for precise applications.

Formula: C₉H₈BrFO

InChI: InChI=1S/C9H8BrFO/c10-8-6-7(2-1-5-12)3-4-9(8)11/h1-4,6,12H,5H2/b2-1+

InChI key: InChIKey=BDGGBESURQUJHW-OWOJBTEDSA-N

SMILES: C(=C/CO)\C1=CC(Br)=C(F)C=C1

Synonyms:

• (2E)-3-(3-Bromo-4-fluorophenyl)-2-propen-1-ol
• 2-Propen-1-ol, 3-(3-bromo-4-fluorophenyl)-, (2E)-