CAS 105919-73-1
:2-Pentyloxycarbanilic acid 1-methoxymethyl-2-(1-perhydroazepinyl)ethyl ester hydrochloride
Description:
2-Pentyloxycarbanilic acid 1-methoxymethyl-2-(1-perhydroazepinyl)ethyl ester hydrochloride, identified by CAS number 105919-73-1, is a chemical compound that exhibits characteristics typical of esters and amines. This substance features a complex molecular structure, incorporating a pentyloxy group, a methoxymethyl moiety, and a perhydroazepinyl ring, which contribute to its unique properties. It is likely to be a white to off-white solid, soluble in organic solvents, and may exhibit moderate solubility in water due to the presence of polar functional groups. The compound may possess biological activity, potentially acting as a pharmaceutical agent, given its structural components that are often associated with medicinal chemistry. Its hydrochloride form indicates that it is a salt, which can enhance its stability and solubility in aqueous environments. As with many organic compounds, it is essential to handle this substance with care, following appropriate safety protocols due to potential toxicity or reactivity.
Formula:C22H36N2O4
InChI:InChI=1/C22H36N2O4/c1-3-4-11-16-27-21-13-8-7-12-20(21)23-22(25)28-19(18-26-2)17-24-14-9-5-6-10-15-24/h7-8,12-13,19H,3-6,9-11,14-18H2,1-2H3,(H,23,25)
Synonyms:- 1-(azepan-1-yl)-3-methoxypropan-2-yl [2-(pentyloxy)phenyl]carbamate
- BK 129
- Carbamic acid, [2-(pentyloxy)phenyl]-, 2-(hexahydro-1H-azepin-1-yl)-1-(methoxymethyl)ethyl ester (9CI)
- 2-Pentyloxycarbanilic acid 1-methoxymethyl-2-(1-perhydroazepinyl)ethyl ester hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
BK 129
CAS:BK 129 is a local anesthetic with relaxant properties. BK 129 inhibits Ca2+ entry into the smooth muscle cell and Ca2+ release from sarcoplasmic reticulum.Formula:C22H36N2O4Purity:98%Color and Shape:SolidMolecular weight:392.53
