CAS 10596-21-1
:bromomethylenebis(phosphonic acid)
Description:
Bromomethylenebis(phosphonic acid), with the CAS number 10596-21-1, is a chemical compound characterized by its unique structure that includes bromine and phosphonic acid functional groups. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its form and purity. It is known for its high reactivity, particularly due to the presence of the bromomethyl group, which can participate in various nucleophilic substitution reactions. The phosphonic acid moieties contribute to its ability to form stable complexes with metal ions, making it useful in applications such as chelation and as a potential agent in water treatment processes. Additionally, bromomethylenebis(phosphonic acid) may exhibit biological activity, which could be of interest in pharmaceutical research. Its solubility in water and polar organic solvents enhances its versatility in various chemical reactions and formulations. However, handling this compound requires caution due to its potential reactivity and the need for appropriate safety measures in laboratory settings.
Formula:CH5BrO6P2
InChI:InChI=1/CH5BrO6P2/c2-1(9(3,4)5)10(6,7)8/h1H,(H2,3,4,5)(H2,6,7,8)
SMILES:C(Br)(P(=O)(O)O)P(=O)(O)O
Synonyms:- P,P'-(Bromomethylene)bisphosphonic Acid
- Bromomethlenediphosphonic Acid
- (Bromomethanediyl)Bis(Phosphonic Acid)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Bromomethylenediphosphonic Acid, 90%
CAS:Formula:CH5BrO6P2Color and Shape:SolidMolecular weight:254.8983Bromomethylenediphosphonic Acid
CAS:Formula:CH5BrO6P2Color and Shape:Off-White SolidMolecular weight:254.90Bromomethylenediphosphonic Acid, 90%
CAS:Controlled ProductApplications An organophosphorus analog of biologically active compounds.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package
References Wang, L., et al.: Cancer Res., 52, 4824 (1992), Kim, S., et al.: J. Biol. Chem., 278, 5072 (2003), Oelschlaeger, P., et al.: J. Mol. Biol., 366, 687 (2003), Sucato, C., et al.: Biochemistry, 46, 461 (2007),Formula:CH5BrO6P2Purity:90%Color and Shape:NeatMolecular weight:254.9


