
CAS 1059626-13-9
:1H-Imidazole-1-ethanamine, N-methyl-2-phenyl-, hydrochloride (1:2)
Description:
1H-Imidazole-1-ethanamine, N-methyl-2-phenyl-, hydrochloride (1:2) is a chemical compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features an ethylamine side chain and a methyl group attached to the nitrogen of the imidazole, along with a phenyl group, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water than its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The compound may exhibit biological activity, potentially acting as a ligand or modulator in biochemical pathways. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its pharmacological profile and potential applications in drug development.
Formula:C12H15N3·2ClH
InChI:InChI=1S/C12H15N3.2ClH/c1-13-7-9-15-10-8-14-12(15)11-5-3-2-4-6-11;;/h2-6,8,10,13H,7,9H2,1H3;2*1H
InChI key:InChIKey=IRDAPVOXLVJXKQ-UHFFFAOYSA-N
SMILES:C(CNC)N1C(=NC=C1)C2=CC=CC=C2.Cl
Synonyms:- 1H-Imidazole-1-ethanamine, N-methyl-2-phenyl-, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.