CAS 105963-46-0
:3,6,6-trimethyl-N-(2-phenylethyl)-5,6-dihydroimidazo[2,1-b][1,3]thiazole-2-carboxamide
Description:
3,6,6-trimethyl-N-(2-phenylethyl)-5,6-dihydroimidazo[2,1-b][1,3]thiazole-2-carboxamide is a complex organic compound characterized by its unique bicyclic structure, which incorporates both imidazole and thiazole rings. This compound features multiple substituents, including three methyl groups and a phenylethyl group, contributing to its diverse chemical properties and potential biological activity. The presence of the carboxamide functional group suggests that it may engage in hydrogen bonding, influencing its solubility and reactivity. Typically, compounds of this nature may exhibit pharmacological properties, making them of interest in medicinal chemistry. The molecular structure can lead to various interactions with biological targets, potentially affecting enzyme activity or receptor binding. Additionally, the compound's stability and reactivity can be influenced by the steric and electronic effects of the substituents. Overall, 3,6,6-trimethyl-N-(2-phenylethyl)-5,6-dihydroimidazo[2,1-b][1,3]thiazole-2-carboxamide represents a class of compounds that may have significant implications in drug development and therapeutic applications.
Formula:C17H21N3OS
InChI:InChI=1/C17H21N3OS/c1-12-14(22-16-19-17(2,3)11-20(12)16)15(21)18-10-9-13-7-5-4-6-8-13/h4-8H,9-11H2,1-3H3,(H,18,21)
SMILES:Cc1c(C(=NCCc2ccccc2)O)sc2=NC(C)(C)Cn12
Synonyms:- Imidazo[2,1-b]thiazole-2-carboxamide, 5,6-dihydro-3,6,6-trimethyl-N-(2-phenylethyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
TOK-8801
CAS:TOK-8801 is a thiazole-2-carboxamide compound that has immunomodulatory, immunopharmacological, and antigen properties. TOK-8801 induces a delayed type hypersensitivity response in mice and inhibits the proliferation of human T cells by inhibiting the binding of CD28 to B7.1 or B7.2. It also has been shown to suppress the growth of T cells by inhibiting IL-2 production and enhance the function of macrophages by inducing IL-12 secretion. TOK-8801 is being investigated as a potential treatment for autoimmune diseases such as systemic lupus erythematosus, rheumatoid arthritis, and multiple sclerosis.
Formula:C17H21N3OSPurity:Min. 95%Molecular weight:315.4 g/molTOK-8801
CAS:TOK-8801 is a dihydroimidazole thiazole carboxamide with immunomodulatory activity.Formula:C17H21N3OSPurity:99.97%Color and Shape:SolidMolecular weight:315.43


