CAS 105973-51-1
:1-Benzyl-3-piperidinol hydrochloride
Description:
1-Benzyl-3-piperidinol hydrochloride is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. This compound features a benzyl group attached to the nitrogen atom of the piperidine, along with a hydroxyl group (-OH) at the 3-position of the ring. As a hydrochloride salt, it is typically encountered in a crystalline form, which enhances its solubility in water and other polar solvents. The presence of the hydroxyl group contributes to its potential as a chiral building block in organic synthesis and pharmaceutical applications. This compound may exhibit various biological activities, making it of interest in medicinal chemistry. Its molecular structure allows for interactions with biological targets, potentially influencing its pharmacological properties. Safety data and handling precautions should be observed, as with all chemical substances, to mitigate any risks associated with its use.
Formula:C12H18NO
InChI:InChI=1/C12H17NO/c14-12-7-4-8-13(10-12)9-11-5-2-1-3-6-11/h1-3,5-6,12,14H,4,7-10H2/p+1/t12-/m0/s1
Synonyms:- (3R)-1-benzyl-3-hydroxypiperidinium
- (3S)-1-benzyl-3-hydroxypiperidinium
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Benzyl-3-piperidinol, HCl
CAS:Formula:C12H18ClNOPurity:98%Color and Shape:SolidMolecular weight:227.73041-Benzylpiperidin-3-ol hydrochloride
CAS:1-Benzylpiperidin-3-ol hydrochloridePurity:98%Molecular weight:227.73g/mol1-Benzyl-3-hydroxypiperidine hydrochloride
CAS:1-Benzyl-3-hydroxypiperidine hydrochloride is a versatile building block that can be used as a research chemical, reagent, speciality chemical or useful building block. It is a high quality compound with many potential uses as a reaction component or scaffold.Formula:C12H17NO·HClPurity:Min. 95%Color and Shape:PowderMolecular weight:227.73 g/mol



