CymitQuimica logo

CAS 105975-49-3

:

benzyl (2S)-2-(benzyloxycarbonylamino)-5-[[N-[bis[(4-nitrophenyl)methoxy]phosphoryl]carbamimidoyl]amino]pentanoate

Description:
Benzyl (2S)-2-(benzyloxycarbonylamino)-5-[[N-[bis[(4-nitrophenyl)methoxy]phosphoryl]carbamimidoyl]amino]pentanoate, with CAS number 105975-49-3, is a complex organic compound characterized by its multi-functional structure. It features a pentanoate backbone, which is an aliphatic chain with a carboxylate group, indicating potential for solubility in organic solvents. The presence of benzyloxycarbonyl and phosphoryl groups suggests that this compound may exhibit significant reactivity and biological activity, potentially serving as a prodrug or in medicinal chemistry applications. The nitrophenyl groups may enhance its electronic properties, influencing its interaction with biological targets. Additionally, the stereochemistry indicated by the (2S) configuration suggests specific spatial arrangements that could affect its pharmacodynamics and pharmacokinetics. Overall, this compound's intricate structure implies potential utility in drug development, particularly in targeting specific biological pathways or mechanisms. However, detailed studies would be necessary to fully understand its properties, reactivity, and potential applications in various fields, including pharmaceuticals and biochemistry.
Formula:C35H37N6O11P
InChI:InChI=1/C35H37N6O11P/c36-34(39-53(48,51-24-28-13-17-30(18-14-28)40(44)45)52-25-29-15-19-31(20-16-29)41(46)47)37-21-7-12-32(33(42)49-22-26-8-3-1-4-9-26)38-35(43)50-23-27-10-5-2-6-11-27/h1-6,8-11,13-20,32H,7,12,21-25H2,(H,38,43)(H3,36,37,39,48)/t32-/m0/s1
SMILES:c1ccc(cc1)COC(=O)[C@H](CCCNC(=N)NP(=O)(OCc1ccc(cc1)N(=O)=O)OCc1ccc(cc1)N(=O)=O)N=C(O)OCc1ccccc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.