CAS 105985-17-9
:3-Chloro-2(1H)-pyrazinone
Description:
3-Chloro-2(1H)-pyrazinone is an organic compound characterized by its pyrazinone structure, which features a five-membered aromatic ring containing two nitrogen atoms. This compound is typically recognized for its chlorinated derivative, where a chlorine atom is substituted at the 3-position of the pyrazinone ring. It exhibits properties common to heterocyclic compounds, including potential biological activity, making it of interest in medicinal chemistry and agrochemical applications. The presence of the pyrazinone moiety suggests that it may participate in various chemical reactions, such as nucleophilic substitutions or cyclization processes. Additionally, its solubility and stability can vary depending on the solvent and environmental conditions. As with many chlorinated compounds, it may also exhibit specific reactivity patterns, including susceptibility to hydrolysis or oxidation. Safety data should be consulted for handling and storage, as chlorinated compounds can pose environmental and health risks. Overall, 3-Chloro-2(1H)-pyrazinone is a compound of interest for further research and application in various chemical fields.
Formula:C4H3ClN2O
InChI:InChI=1S/C4H3ClN2O/c5-3-4(8)7-2-1-6-3/h1-2H,(H,7,8)
InChI key:InChIKey=GRTBIIMNXROPAX-UHFFFAOYSA-N
SMILES:ClC=1C(=O)NC=CN1
Synonyms:- 3-Chloro-1,2-dihydropyrazin-2-one
- 3-Chloro-1H-pyrazin-2-one
- 3-Chloro-2(1H)-pyrazinone
- 3-Chloropyrazin-2-ol
- 2(1H)-Pyrazinone, 3-chloro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Chloropyrazin-2(1H)-one
CAS:Formula:C4H3ClN2OPurity:97%Color and Shape:No data available.Molecular weight:130.533-Chloropyrazin-2(1H)-one
CAS:3-Chloropyrazin-2(1H)-one is an organic compound with the molecular formula C6H5ClO. It is a colorless liquid that spontaneously polymerizes. 3-Chloropyrazin-2(1H)-one has been shown to have a number of functions, including reactions with cyclohexanone and acetone to produce ethyl formate, as well as reactions with acetonitrile and ethyl formate to produce 2-ethoxyethyl acetate. Phase equilibrium data for 3-chloropyrazin-2(1H)-one are given in terms of the liquid and vapor phases at various pressures and temperatures. The solvents used in crystallographic studies of 3-chloropyrazin-2(1H)-one include tetrahydrofuran (THF) and dimethyl sulfoxide (DMSO). Experimental data for 3-chloropyrazin-2(1H)-one is
Formula:C4H3ClN2OPurity:Min. 95%Molecular weight:130.53 g/molRef: 3D-FEA98517
Discontinued product



