CymitQuimica logo

CAS 10599-17-4

:

1-(3-chloropropyl)-4-phenylpiperazine

Description:
1-(3-Chloropropyl)-4-phenylpiperazine, identified by its CAS number 10599-17-4, is a chemical compound that belongs to the piperazine class of compounds. It features a piperazine ring, which is a six-membered ring containing two nitrogen atoms, and is substituted with a phenyl group and a 3-chloropropyl chain. This structure contributes to its potential biological activity, making it of interest in medicinal chemistry and pharmacology. The presence of the chlorine atom and the propyl chain can influence its lipophilicity and interaction with biological targets. The compound may exhibit various properties, including solubility in organic solvents and potential reactivity with electrophiles or nucleophiles due to the functional groups present. Its synthesis typically involves multi-step organic reactions, and it may be studied for its effects on neurotransmitter systems, given the piperazine moiety's relevance in psychopharmacology. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity or reactivity.
Formula:C13H19ClN2
InChI:InChI=1/C13H19ClN2/c14-7-4-8-15-9-11-16(12-10-15)13-5-2-1-3-6-13/h1-3,5-6H,4,7-12H2
SMILES:c1ccc(cc1)N1CCN(CCCCl)CC1
Synonyms:
  • Piperazine, 1-(3-chloropropyl)-4-phenyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.