CAS 105994-80-7

α-Methyl-4-(1-methylethyl)benzeneethanol

Description:

α-Methyl-4-(1-methylethyl)benzeneethanol, also known as a derivative of phenolic compounds, is characterized by its aromatic structure, which includes a benzene ring substituted with both a methyl group and an isopropyl group, along with a hydroxyl (-OH) functional group. This compound typically exhibits properties associated with alcohols, such as solubility in organic solvents and potential hydrogen bonding capabilities due to the presence of the hydroxyl group. Its molecular structure suggests it may have applications in organic synthesis or as an intermediate in the production of various chemical products. The presence of the bulky isopropyl group can influence its physical properties, such as boiling point and viscosity, and may also affect its reactivity and interactions with other substances. Additionally, the compound may exhibit specific biological activities, making it of interest in fields such as pharmaceuticals or agrochemicals. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.

Formula: C₁₂H₁₈O

InChI: InChI=1S/C12H18O/c1-9(2)12-6-4-11(5-7-12)8-10(3)13/h4-7,9-10,13H,8H2,1-3H3

InChI key: InChIKey=OYDGTBAXIOLNFE-UHFFFAOYSA-N

SMILES: C(C(C)O)C1=CC=C(C(C)C)C=C1

Synonyms:

• Benzeneethanol, α-methyl-4-(1-methylethyl)-
• 1-[4-(Propan-2-yl)phenyl]propan-2-ol
• α-Methyl-4-(1-methylethyl)benzeneethanol
• 1-(4-Iso-Propylphenyl)-2-propanol