CAS 105995-43-5
:3,5-BIS-AMINOMETHYL-BENZOIC ACID
Description:
3,5-Bis(aminomethyl)benzoic acid, identified by its CAS number 105995-43-5, is an organic compound characterized by the presence of two aminomethyl groups attached to a benzoic acid structure. This compound features a benzene ring with carboxylic acid functionality, which contributes to its acidic properties. The aminomethyl groups enhance its potential for forming hydrogen bonds, making it a candidate for various applications in pharmaceuticals and materials science. It is typically a white to off-white solid and is soluble in polar solvents due to the presence of both amino and carboxylic acid functional groups. The compound may exhibit biological activity, potentially serving as a building block in drug synthesis or as a ligand in coordination chemistry. Its reactivity can be influenced by the amino groups, allowing for further derivatization or polymerization. Safety data should be consulted for handling, as with any chemical, to ensure proper precautions are taken during use.
Formula:C9H12N2O2
InChI:InChI=1/C9H12N2O2/c10-4-6-1-7(5-11)3-8(2-6)9(12)13/h1-3H,4-5,10-11H2,(H,12,13)
SMILES:c1c(cc(cc1CN)C(=O)O)CN
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
