
CAS 106-08-1
:26-Hydroxy-3,6,9,12,15,18,21,24-octaoxahexacos-1-yl dodecanoate
Description:
26-Hydroxy-3,6,9,12,15,18,21,24-octaoxahexacos-1-yl dodecanoate, with CAS number 106-08-1, is a chemical compound characterized by its long-chain structure, which includes multiple ether linkages due to the presence of octaoxahexacosane moiety. This compound features a hydroxyl group at the 26th position and a dodecanoate (lauric acid) ester group, contributing to its amphiphilic nature. The presence of both hydrophilic (due to the hydroxyl and ether groups) and hydrophobic (from the long hydrocarbon chain and dodecanoate) segments allows it to function effectively as a surfactant or emulsifier in various applications. It is often utilized in the formulation of cosmetics, pharmaceuticals, and food products due to its ability to stabilize mixtures of oil and water. Additionally, its unique structure may impart specific properties such as solubility in organic solvents and potential biocompatibility, making it of interest in both industrial and biomedical fields. Safety and handling precautions should be observed, as with any chemical substance, to mitigate potential hazards.
Formula:C30H60O11
InChI:InChI=1S/C30H60O11/c1-2-3-4-5-6-7-8-9-10-11-30(32)41-29-28-40-27-26-39-25-24-38-23-22-37-21-20-36-19-18-35-17-16-34-15-14-33-13-12-31/h31H,2-29H2,1H3
InChI key:InChIKey=FGGVRPFJBBRZFG-UHFFFAOYSA-N
SMILES:C(OCCOCCOCCOCCOCCOCCOCCOCCOCCO)(CCCCCCCCCCC)=O
Synonyms:- Lauric acid, 2-[2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl ester
- Nonaethylene glycol, monolaurate
- 26-Hydroxy-3,6,9,12,15,18,21,24-octaoxahexacos-1-yl dodecanoate
- Lauric acid, ester with nonaethylene glycol
- Dodecanoic acid, 26-hydroxy-3,6,9,12,15,18,21,24-octaoxahexacos-1-yl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Dodecanoic acid,26-hydroxy-3,6,9,12,15,18,21,24-octaoxahexacos-1-yl ester
CAS:Formula:C30H60O11Molecular weight:596.7907999999999PEG-9 Laurate
CAS:<p>PEG-9 Laurate is a bioactive chemical.</p>Formula:C30H60O11Color and Shape:SolidMolecular weight:596.79

